C40H31FO5 — CID 129419567
[(1R,2S,3R,4R,5R)-3,4-dibenzoyl-2-(4-fluorobenzoyl)-5-hydroxy-5-phenylcyclohexyl]-phenylmethanone (PubChem CID 129419567) has the molecular formula C40H31FO5 and a molecular weight of 610.68 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5R)-3,4-dibenzoyl-2-(4-fluorobenzoyl)-5-hydroxy-5-phenylcyclohexyl]-phenylmethanone.
| Compound Name | [(1R,2S,3R,4R,5R)-3,4-dibenzoyl-2-(4-fluorobenzoyl)-5-hydroxy-5-phenylcyclohexyl]-phenylmethanone |
|---|---|
| PubChem CID | 129419567 |
| Molecular Formula | C40H31FO5 |
| Molecular Weight | 610.68 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | [(1R,2S,3R,4R,5R)-3,4-dibenzoyl-2-(4-fluorobenzoyl)-5-hydroxy-5-phenylcyclohexyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](C(=O)c2ccc(F)cc2)[C@H](C(=O)c2ccccc2)C[C@](O)(c2ccccc2)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C40H31FO5/c41-31-23-21-29(22-24-31)37(43)33-32(36(42)26-13-5-1-6-14-26)25-40(46,30-19-11-4-12-20-30)35(39(45)28-17-9-3-10-18-28)34(33)38(44)27-15-7-2-8-16-27/h1-24,32-35,46H,25H2/t32-,33+,34-,35+,40+/m1/s1 |
| InChIKey | RQBNAKHINGIZDP-MYKXGQLFSA-N |
| XLogP | 7.41 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.68 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |