C33H26N2O2 — CID 139069447
(2S,3R,4S,6R)-3-benzoyl-4-hydroxy-2,4,6-triphenylcyclohexane-1,1-dicarbonitrile (PubChem CID 139069447) has the molecular formula C33H26N2O2 and a molecular weight of 482.58 g/mol. Its IUPAC name is (2S,3R,4S,6R)-3-benzoyl-4-hydroxy-2,4,6-triphenylcyclohexane-1,1-dicarbonitrile.
| Compound Name | (2S,3R,4S,6R)-3-benzoyl-4-hydroxy-2,4,6-triphenylcyclohexane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 139069447 |
| Molecular Formula | C33H26N2O2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | (2S,3R,4S,6R)-3-benzoyl-4-hydroxy-2,4,6-triphenylcyclohexane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@@H](c2ccccc2)C[C@@](O)(c2ccccc2)[C@H](C(=O)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C33H26N2O2/c34-22-32(23-35)28(24-13-5-1-6-14-24)21-33(37,27-19-11-4-12-20-27)30(29(32)25-15-7-2-8-16-25)31(36)26-17-9-3-10-18-26/h1-20,28-30,37H,21H2/t28-,29-,30+,33-/m1/s1 |
| InChIKey | OMTITVJCPGGEFQ-LFQASTLSSA-N |
| XLogP | 6.38 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |