C23H16F6N2O2 — CID 124833525
(2S,3R,4R,6S)-4-hydroxy-2,6-diphenyl-3-(2,2,2-trifluoroacetyl)-4-(trifluoromethyl)cyclohexane-1,1-dicarbonitrile (PubChem CID 124833525) has the molecular formula C23H16F6N2O2 and a molecular weight of 466.38 g/mol. Its IUPAC name is (2S,3R,4R,6S)-4-hydroxy-2,6-diphenyl-3-(2,2,2-trifluoroacetyl)-4-(trifluoromethyl)cyclohexane-1,1-dicarbonitrile.
| Compound Name | (2S,3R,4R,6S)-4-hydroxy-2,6-diphenyl-3-(2,2,2-trifluoroacetyl)-4-(trifluoromethyl)cyclohexane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 124833525 |
| Molecular Formula | C23H16F6N2O2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (2S,3R,4R,6S)-4-hydroxy-2,6-diphenyl-3-(2,2,2-trifluoroacetyl)-4-(trifluoromethyl)cyclohexane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@H](c2ccccc2)[C@@H](C(=O)C(F)(F)F)[C@@](O)(C(F)(F)F)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H16F6N2O2/c24-22(25,26)19(32)18-17(15-9-5-2-6-10-15)20(12-30,13-31)16(14-7-3-1-4-8-14)11-21(18,33)23(27,28)29/h1-10,16-18,33H,11H2/t16-,17+,18-,21+/m0/s1 |
| InChIKey | OFYBRSREMVRCFU-TWFHAPMSSA-N |
| XLogP | 5.03 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |