C17H9F3N2O2 — CID 141135822
2-(furan-2-carbonyl)-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarbonitrile (PubChem CID 141135822) has the molecular formula C17H9F3N2O2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 2-(furan-2-carbonyl)-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarbonitrile.
| Compound Name | 2-(furan-2-carbonyl)-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 141135822 |
| Molecular Formula | C17H9F3N2O2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-(furan-2-carbonyl)-3-[4-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)C(C(=O)c2ccco2)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H9F3N2O2/c18-17(19,20)11-5-3-10(4-6-11)13-14(16(13,8-21)9-22)15(23)12-2-1-7-24-12/h1-7,13-14H |
| InChIKey | ZQJMKVJQLODYTO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_B(3)', 'substructure': 'N/A'} |
|---|