C17H12N2O3 — CID 141139260
trans-(2S,3R)-2-(furan-2-carbonyl)-3-(4-methoxyphenyl)cyclopropane-1,1-dicarbonitrile (PubChem CID 141139260) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is trans-(2S,3R)-2-(furan-2-carbonyl)-3-(4-methoxyphenyl)cyclopropane-1,1-dicarbonitrile.
| Compound Name | trans-(2S,3R)-2-(furan-2-carbonyl)-3-(4-methoxyphenyl)cyclopropane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 141139260 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | trans-(2S,3R)-2-(furan-2-carbonyl)-3-(4-methoxyphenyl)cyclopropane-1,1-dicarbonitrile |
| SMILES | COc1ccc([C@H]2[C@H](C(=O)c3ccco3)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C17H12N2O3/c1-21-12-6-4-11(5-7-12)14-15(17(14,9-18)10-19)16(20)13-3-2-8-22-13/h2-8,14-15H,1H3/t14-,15+/m0/s1 |
| InChIKey | KSBLNHQMHYPVRG-LSDHHAIUSA-N |
| XLogP | 2.92 |
| TPSA | 87.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_B(3)', 'substructure': 'N/A'} |
|---|