C17H14N2O2S2 — CID 15339395
(1S,2S,3S)-1-cyano-2-(4-methoxyphenyl)-3-(thiophene-2-carbonyl)cyclopropane-1-carbothioamide (PubChem CID 15339395) has the molecular formula C17H14N2O2S2 and a molecular weight of 342.45 g/mol. Its IUPAC name is (1S,2S,3S)-1-cyano-2-(4-methoxyphenyl)-3-(thiophene-2-carbonyl)cyclopropane-1-carbothioamide.
| Compound Name | (1S,2S,3S)-1-cyano-2-(4-methoxyphenyl)-3-(thiophene-2-carbonyl)cyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 15339395 |
| Molecular Formula | C17H14N2O2S2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (1S,2S,3S)-1-cyano-2-(4-methoxyphenyl)-3-(thiophene-2-carbonyl)cyclopropane-1-carbothioamide |
| SMILES | COc1ccc([C@@H]2[C@H](C(=O)c3cccs3)[C@@]2(C#N)C(N)=S)cc1 |
| InChI | InChI=1S/C17H14N2O2S2/c1-21-11-6-4-10(5-7-11)13-14(17(13,9-18)16(19)22)15(20)12-3-2-8-23-12/h2-8,13-14H,1H3,(H2,19,22)/t13-,14-,17+/m1/s1 |
| InChIKey | ASEFNJLKPCZSHX-CPUCHLNUSA-N |
| XLogP | 3.15 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|