About trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile
trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile (PubChem CID 141139275) has the molecular formula C16H9ClN2OS
and a molecular weight of 312.78 g/mol. Its IUPAC name is trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile |
| PubChem CID | 141139275 |
| Molecular Formula | C16H9ClN2OS |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@@H](C(=O)c2cccs2)[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C16H9ClN2OS/c17-11-5-2-1-4-10(11)13-14(16(13,8-18)9-19)15(20)12-6-3-7-21-12/h1-7,13-14H/t13-,14+/m0/s1 |
| InChIKey | RDDWNBPJUDWVHJ-UONOGXRCSA-N |
| XLogP | 4.03 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_cyano_B(3)', 'substructure': 'N/A'} |
|---|
Analyze trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile?
The IUPAC name of trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile (CID 141139275) is trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile.
What is the SMILES notation for trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile?
The canonical SMILES for trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile is N#CC1(C#N)[C@@H](C(=O)c2cccs2)[C@@H]1c1ccccc1Cl.
What is the InChIKey of trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile?
The InChIKey is RDDWNBPJUDWVHJ-UONOGXRCSA-N. The full InChI is InChI=1S/C16H9ClN2OS/c17-11-5-2-1-4-10(11)13-14(16(13,8-18)9-19)15(20)12-6-3-7-21-12/h1-7,13-14H/t13-,14+/m0/s1.
What are the key properties of trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile?
trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile has a molecular weight of 312.78 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,3S)-2-(2-chlorophenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile is sourced from PubChem (CID 141139275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).