C17H12N2O2S — CID 141139272
trans-(2R,3S)-2-(4-methoxyphenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile (PubChem CID 141139272) has the molecular formula C17H12N2O2S and a molecular weight of 308.36 g/mol. Its IUPAC name is trans-(2R,3S)-2-(4-methoxyphenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile.
| Compound Name | trans-(2R,3S)-2-(4-methoxyphenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 141139272 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | trans-(2R,3S)-2-(4-methoxyphenyl)-3-(thiophene-2-carbonyl)cyclopropane-1,1-dicarbonitrile |
| SMILES | COc1ccc([C@H]2[C@H](C(=O)c3cccs3)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C17H12N2O2S/c1-21-12-6-4-11(5-7-12)14-15(17(14,9-18)10-19)16(20)13-3-2-8-22-13/h2-8,14-15H,1H3/t14-,15+/m0/s1 |
| InChIKey | OEKBYAHKRYEYDC-LSDHHAIUSA-N |
| XLogP | 3.39 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_B(3)', 'substructure': 'N/A'} |
|---|