C18H10Cl2N2O — CID 11371238
cis-(2R,3S)-2-benzoyl-3-(2,4-dichlorophenyl)cyclopropane-1,1-dicarbonitrile (PubChem CID 11371238) has the molecular formula C18H10Cl2N2O and a molecular weight of 341.20 g/mol. Its IUPAC name is cis-(2R,3S)-2-benzoyl-3-(2,4-dichlorophenyl)cyclopropane-1,1-dicarbonitrile.
| Compound Name | cis-(2R,3S)-2-benzoyl-3-(2,4-dichlorophenyl)cyclopropane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 11371238 |
| Molecular Formula | C18H10Cl2N2O |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | cis-(2R,3S)-2-benzoyl-3-(2,4-dichlorophenyl)cyclopropane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@H](C(=O)c2ccccc2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H10Cl2N2O/c19-12-6-7-13(14(20)8-12)15-16(18(15,9-21)10-22)17(23)11-4-2-1-3-5-11/h1-8,15-16H/t15-,16-/m0/s1 |
| InChIKey | KBEDYUZPEILPNS-HOTGVXAUSA-N |
| XLogP | 4.62 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_cyano_B(3)', 'substructure': 'N/A'} |
|---|