C12H8FN3O — CID 5117402
2,2-dicyano-3-(2-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 5117402) has the molecular formula C12H8FN3O and a molecular weight of 229.21 g/mol. Its IUPAC name is 2,2-dicyano-3-(2-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dicyano-3-(2-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 5117402 |
| Molecular Formula | C12H8FN3O |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2,2-dicyano-3-(2-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | N#CC1(C#N)C(C(N)=O)C1c1ccccc1F |
| InChI | InChI=1S/C12H8FN3O/c13-8-4-2-1-3-7(8)9-10(11(16)17)12(9,5-14)6-15/h1-4,9-10H,(H2,16,17) |
| InChIKey | YZEQSTKRDVJDLQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 90.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |