C14H8F3NO3 — CID 70391342
3-(furan-2-carbonyl)-5-(trifluoromethyl)-1,3-dihydroindol-2-one (PubChem CID 70391342) has the molecular formula C14H8F3NO3 and a molecular weight of 295.22 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-5-(trifluoromethyl)-1,3-dihydroindol-2-one.
| Compound Name | 3-(furan-2-carbonyl)-5-(trifluoromethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 70391342 |
| Molecular Formula | C14H8F3NO3 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-(furan-2-carbonyl)-5-(trifluoromethyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(C(F)(F)F)cc2C1C(=O)c1ccco1 |
| InChI | InChI=1S/C14H8F3NO3/c15-14(16,17)7-3-4-9-8(6-7)11(13(20)18-9)12(19)10-2-1-5-21-10/h1-6,11H,(H,18,20) |
| InChIKey | PAOHOTMVBPLGIG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|