C13H12F3NO — CID 122387866
(3aR,9bR)-8-(trifluoromethyl)-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-4-one (PubChem CID 122387866) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is (3aR,9bR)-8-(trifluoromethyl)-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-4-one.
| Compound Name | (3aR,9bR)-8-(trifluoromethyl)-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-4-one |
|---|---|
| PubChem CID | 122387866 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (3aR,9bR)-8-(trifluoromethyl)-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-4-one |
| SMILES | O=C1Nc2ccc(C(F)(F)F)cc2[C@@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C13H12F3NO/c14-13(15,16)7-4-5-11-10(6-7)8-2-1-3-9(8)12(18)17-11/h4-6,8-9H,1-3H2,(H,17,18)/t8-,9-/m1/s1 |
| InChIKey | SREDABSPIJGOFW-RKDXNWHRSA-N |
| XLogP | 3.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |