C20H18F3NO2 — CID 71766413
4-[(3aS,4R,9bR)-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]benzoic acid (PubChem CID 71766413) has the molecular formula C20H18F3NO2 and a molecular weight of 361.36 g/mol. Its IUPAC name is 4-[(3aS,4R,9bR)-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]benzoic acid.
| Compound Name | 4-[(3aS,4R,9bR)-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 71766413 |
| Molecular Formula | C20H18F3NO2 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-[(3aS,4R,9bR)-8-(trifluoromethyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccc([C@@H]2Nc3ccc(C(F)(F)F)cc3[C@@H]3CCC[C@@H]32)cc1 |
| InChI | InChI=1S/C20H18F3NO2/c21-20(22,23)13-8-9-17-16(10-13)14-2-1-3-15(14)18(24-17)11-4-6-12(7-5-11)19(25)26/h4-10,14-15,18,24H,1-3H2,(H,25,26)/t14-,15+,18+/m1/s1 |
| InChIKey | GIAZBMOZBJJXTQ-VKJFTORMSA-N |
| XLogP | 5.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |