C21H22ClNO2 — CID 154081190
methyl 4-[(6R,6aS,10aR)-2-chloro-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-6-yl]benzoate (PubChem CID 154081190) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is methyl 4-[(6R,6aS,10aR)-2-chloro-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-6-yl]benzoate.
| Compound Name | methyl 4-[(6R,6aS,10aR)-2-chloro-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-6-yl]benzoate |
|---|---|
| PubChem CID | 154081190 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | methyl 4-[(6R,6aS,10aR)-2-chloro-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2Nc3ccc(Cl)cc3[C@@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C21H22ClNO2/c1-25-21(24)14-8-6-13(7-9-14)20-17-5-3-2-4-16(17)18-12-15(22)10-11-19(18)23-20/h6-12,16-17,20,23H,2-5H2,1H3/t16-,17+,20+/m1/s1 |
| InChIKey | GHVJSHNNYDPVKR-UWVAXJGDSA-N |
| XLogP | 5.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |