C23H26FNO2 — CID 154081186
methyl 4-[(6S,6aS,10aR)-2-ethyl-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-6-yl]-3-fluorobenzoate (PubChem CID 154081186) has the molecular formula C23H26FNO2 and a molecular weight of 367.46 g/mol. Its IUPAC name is methyl 4-[(6S,6aS,10aR)-2-ethyl-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-6-yl]-3-fluorobenzoate.
| Compound Name | methyl 4-[(6S,6aS,10aR)-2-ethyl-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-6-yl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 154081186 |
| Molecular Formula | C23H26FNO2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | methyl 4-[(6S,6aS,10aR)-2-ethyl-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-6-yl]-3-fluorobenzoate |
| SMILES | CCc1ccc2c(c1)[C@@H]1CCCC[C@@H]1[C@@H](c1ccc(C(=O)OC)cc1F)N2 |
| InChI | InChI=1S/C23H26FNO2/c1-3-14-8-11-21-19(12-14)16-6-4-5-7-17(16)22(25-21)18-10-9-15(13-20(18)24)23(26)27-2/h8-13,16-17,22,25H,3-7H2,1-2H3/t16-,17+,22+/m1/s1 |
| InChIKey | ZNRIBPHTKWIOJU-JLHGSKIFSA-N |
| XLogP | 5.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |