C19H21NO2 — CID 82579164
methyl 9-(2-aminoethyl)-7-ethyl-9H-fluorene-2-carboxylate (PubChem CID 82579164) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is methyl 9-(2-aminoethyl)-7-ethyl-9H-fluorene-2-carboxylate.
| Compound Name | methyl 9-(2-aminoethyl)-7-ethyl-9H-fluorene-2-carboxylate |
|---|---|
| PubChem CID | 82579164 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | methyl 9-(2-aminoethyl)-7-ethyl-9H-fluorene-2-carboxylate |
| SMILES | CCc1ccc2c(c1)C(CCN)c1cc(C(=O)OC)ccc1-2 |
| InChI | InChI=1S/C19H21NO2/c1-3-12-4-6-14-15-7-5-13(19(21)22-2)11-18(15)16(8-9-20)17(14)10-12/h4-7,10-11,16H,3,8-9,20H2,1-2H3 |
| InChIKey | GQTBDGBEHRSUJC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |