About methyl 4-(aminomethyl)benzoate;molecular hydrogen
methyl 4-(aminomethyl)benzoate;molecular hydrogen (PubChem CID 143345470) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is methyl 4-(aminomethyl)benzoate;molecular hydrogen.
Molecular Properties
| Compound Name | methyl 4-(aminomethyl)benzoate;molecular hydrogen |
| PubChem CID | 143345470 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | methyl 4-(aminomethyl)benzoate;molecular hydrogen |
| SMILES | COC(=O)c1ccc(CN)cc1.[H][H] |
| InChI | InChI=1S/C9H11NO2.H2/c1-12-9(11)8-4-2-7(6-10)3-5-8;/h2-5H,6,10H2,1H3;1H |
| InChIKey | ALACJQWXMGWHJD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-(aminomethyl)benzoate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(aminomethyl)benzoate;molecular hydrogen?
The IUPAC name of methyl 4-(aminomethyl)benzoate;molecular hydrogen (CID 143345470) is methyl 4-(aminomethyl)benzoate;molecular hydrogen.
What is the SMILES notation for methyl 4-(aminomethyl)benzoate;molecular hydrogen?
The canonical SMILES for methyl 4-(aminomethyl)benzoate;molecular hydrogen is COC(=O)c1ccc(CN)cc1.[H][H].
What is the InChIKey of methyl 4-(aminomethyl)benzoate;molecular hydrogen?
The InChIKey is ALACJQWXMGWHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.H2/c1-12-9(11)8-4-2-7(6-10)3-5-8;/h2-5H,6,10H2,1H3;1H.
What are the key properties of methyl 4-(aminomethyl)benzoate;molecular hydrogen?
methyl 4-(aminomethyl)benzoate;molecular hydrogen has a molecular weight of 167.21 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(aminomethyl)benzoate;molecular hydrogen is sourced from PubChem (CID 143345470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).