C19H24ClN3O4S — CID 159987936
methyl 4-(aminomethyl)benzoate;methyl 4-[(carbamothioylamino)methyl]benzoate;hydrochloride (PubChem CID 159987936) has the molecular formula C19H24ClN3O4S and a molecular weight of 425.94 g/mol. Its IUPAC name is methyl 4-(aminomethyl)benzoate;methyl 4-[(carbamothioylamino)methyl]benzoate;hydrochloride.
| Compound Name | methyl 4-(aminomethyl)benzoate;methyl 4-[(carbamothioylamino)methyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 159987936 |
| Molecular Formula | C19H24ClN3O4S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | methyl 4-(aminomethyl)benzoate;methyl 4-[(carbamothioylamino)methyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(CN)cc1.COC(=O)c1ccc(CNC(N)=S)cc1.Cl |
| InChI | InChI=1S/C10H12N2O2S.C9H11NO2.ClH/c1-14-9(13)8-4-2-7(3-5-8)6-12-10(11)15;1-12-9(11)8-4-2-7(6-10)3-5-8;/h2-5H,6H2,1H3,(H3,11,12,15);2-5H,6,10H2,1H3;1H |
| InChIKey | KHLJODCDZIJXLL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|