C33H40O3 — CID 10413065
methyl 4-[4-(2,7-ditert-butyl-9H-fluoren-9-yl)butoxy]benzoate (PubChem CID 10413065) has the molecular formula C33H40O3 and a molecular weight of 484.68 g/mol. Its IUPAC name is methyl 4-[4-(2,7-ditert-butyl-9H-fluoren-9-yl)butoxy]benzoate.
| Compound Name | methyl 4-[4-(2,7-ditert-butyl-9H-fluoren-9-yl)butoxy]benzoate |
|---|---|
| PubChem CID | 10413065 |
| Molecular Formula | C33H40O3 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | methyl 4-[4-(2,7-ditert-butyl-9H-fluoren-9-yl)butoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCCCC2c3cc(C(C)(C)C)ccc3-c3ccc(C(C)(C)C)cc32)cc1 |
| InChI | InChI=1S/C33H40O3/c1-32(2,3)23-13-17-27-28-18-14-24(33(4,5)6)21-30(28)26(29(27)20-23)10-8-9-19-36-25-15-11-22(12-16-25)31(34)35-7/h11-18,20-21,26H,8-10,19H2,1-7H3 |
| InChIKey | SRZFMLFBTROWQB-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|