C25H32O7 — CID 18348588
methyl 4-[4-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-2-yl)butoxy]benzoate (PubChem CID 18348588) has the molecular formula C25H32O7 and a molecular weight of 444.52 g/mol. Its IUPAC name is methyl 4-[4-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-2-yl)butoxy]benzoate.
| Compound Name | methyl 4-[4-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-2-yl)butoxy]benzoate |
|---|---|
| PubChem CID | 18348588 |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | methyl 4-[4-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-2-yl)butoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCCCC2Cc3c(c(OC)c(OC)c(OC)c3OC)C2)cc1 |
| InChI | InChI=1S/C25H32O7/c1-27-21-19-14-16(15-20(19)22(28-2)24(30-4)23(21)29-3)8-6-7-13-32-18-11-9-17(10-12-18)25(26)31-5/h9-12,16H,6-8,13-15H2,1-5H3 |
| InChIKey | VEAFEBBGPPLPKX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|