C25H35NO5 — CID 18348595
N,N-dimethyl-1-[4-[3-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-2-yl)propoxy]phenyl]methanamine (PubChem CID 18348595) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is N,N-dimethyl-1-[4-[3-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-2-yl)propoxy]phenyl]methanamine.
| Compound Name | N,N-dimethyl-1-[4-[3-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-2-yl)propoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 18348595 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | N,N-dimethyl-1-[4-[3-(4,5,6,7-tetramethoxy-2,3-dihydro-1H-inden-2-yl)propoxy]phenyl]methanamine |
| SMILES | COc1c2c(c(OC)c(OC)c1OC)CC(CCCOc1ccc(CN(C)C)cc1)C2 |
| InChI | InChI=1S/C25H35NO5/c1-26(2)16-17-9-11-19(12-10-17)31-13-7-8-18-14-20-21(15-18)23(28-4)25(30-6)24(29-5)22(20)27-3/h9-12,18H,7-8,13-16H2,1-6H3 |
| InChIKey | MRKDQLHCUKOOOI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|