C18H24N2O5S2 — CID 58820983
N-[3-[4-[(dimethylamino)methyl]phenoxy]propylsulfonyl]benzenesulfonamide (PubChem CID 58820983) has the molecular formula C18H24N2O5S2 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[3-[4-[(dimethylamino)methyl]phenoxy]propylsulfonyl]benzenesulfonamide.
| Compound Name | N-[3-[4-[(dimethylamino)methyl]phenoxy]propylsulfonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58820983 |
| Molecular Formula | C18H24N2O5S2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[3-[4-[(dimethylamino)methyl]phenoxy]propylsulfonyl]benzenesulfonamide |
| SMILES | CN(C)Cc1ccc(OCCCS(=O)(=O)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H24N2O5S2/c1-20(2)15-16-9-11-17(12-10-16)25-13-6-14-26(21,22)19-27(23,24)18-7-4-3-5-8-18/h3-5,7-12,19H,6,13-15H2,1-2H3 |
| InChIKey | QGHLSQBITBBQAR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|