C22H36N2O — CID 166529218
N,N-dimethyl-3-phenoxypropan-1-amine;N,N-dimethyl-1-phenylmethanamine;ethane (PubChem CID 166529218) has the molecular formula C22H36N2O and a molecular weight of 344.54 g/mol. Its IUPAC name is N,N-dimethyl-3-phenoxypropan-1-amine;N,N-dimethyl-1-phenylmethanamine;ethane.
| Compound Name | N,N-dimethyl-3-phenoxypropan-1-amine;N,N-dimethyl-1-phenylmethanamine;ethane |
|---|---|
| PubChem CID | 166529218 |
| Molecular Formula | C22H36N2O |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | N,N-dimethyl-3-phenoxypropan-1-amine;N,N-dimethyl-1-phenylmethanamine;ethane |
| SMILES | CC.CN(C)CCCOc1ccccc1.CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C11H17NO.C9H13N.C2H6/c1-12(2)9-6-10-13-11-7-4-3-5-8-11;1-10(2)8-9-6-4-3-5-7-9;1-2/h3-5,7-8H,6,9-10H2,1-2H3;3-7H,8H2,1-2H3;1-2H3 |
| InChIKey | GJPOOWYUBHRWML-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|