C21H30N2O — CID 90762189
N,N-dimethyl-3-[3-[[methyl-[(4-methylphenyl)methyl]amino]methyl]phenoxy]propan-1-amine (PubChem CID 90762189) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-[[methyl-[(4-methylphenyl)methyl]amino]methyl]phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[3-[[methyl-[(4-methylphenyl)methyl]amino]methyl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 90762189 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | N,N-dimethyl-3-[3-[[methyl-[(4-methylphenyl)methyl]amino]methyl]phenoxy]propan-1-amine |
| SMILES | Cc1ccc(CN(C)Cc2cccc(OCCCN(C)C)c2)cc1 |
| InChI | InChI=1S/C21H30N2O/c1-18-9-11-19(12-10-18)16-23(4)17-20-7-5-8-21(15-20)24-14-6-13-22(2)3/h5,7-12,15H,6,13-14,16-17H2,1-4H3 |
| InChIKey | KTSUCIRKRICIJU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|