C16H20N2O3S — CID 34600685
4-[2-[benzyl(methyl)amino]ethoxy]benzenesulfonamide (PubChem CID 34600685) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-[2-[benzyl(methyl)amino]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[benzyl(methyl)amino]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 34600685 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-[2-[benzyl(methyl)amino]ethoxy]benzenesulfonamide |
| SMILES | CN(CCOc1ccc(S(N)(=O)=O)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H20N2O3S/c1-18(13-14-5-3-2-4-6-14)11-12-21-15-7-9-16(10-8-15)22(17,19)20/h2-10H,11-13H2,1H3,(H2,17,19,20) |
| InChIKey | PWHMRCWLOIUWGN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |