C22H26N2O3S2 — CID 34716492
4-[2-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)amino]ethoxy]benzenesulfonamide (PubChem CID 34716492) has the molecular formula C22H26N2O3S2 and a molecular weight of 430.60 g/mol. Its IUPAC name is 4-[2-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)amino]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)amino]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 34716492 |
| Molecular Formula | C22H26N2O3S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4-[2-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)amino]ethoxy]benzenesulfonamide |
| SMILES | Cc1ccc(CN(CCOc2ccc(S(N)(=O)=O)cc2)CCc2ccccc2)s1 |
| InChI | InChI=1S/C22H26N2O3S2/c1-18-7-10-21(28-18)17-24(14-13-19-5-3-2-4-6-19)15-16-27-20-8-11-22(12-9-20)29(23,25)26/h2-12H,13-17H2,1H3,(H2,23,25,26) |
| InChIKey | RGQFOKHGKCKSMA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |