C21H29N3O4S2 — CID 55861816
ethyl 4-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)sulfamoyl]piperazine-1-carboxylate (PubChem CID 55861816) has the molecular formula C21H29N3O4S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is ethyl 4-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)sulfamoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)sulfamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55861816 |
| Molecular Formula | C21H29N3O4S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | ethyl 4-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)sulfamoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)N(CCc2ccccc2)Cc2ccc(C)s2)CC1 |
| InChI | InChI=1S/C21H29N3O4S2/c1-3-28-21(25)22-13-15-23(16-14-22)30(26,27)24(17-20-10-9-18(2)29-20)12-11-19-7-5-4-6-8-19/h4-10H,3,11-17H2,1-2H3 |
| InChIKey | BFHWOWZZJHVVRJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |