C17H23ClN2OS — CID 120884701
N-(2-aminoethyl)-2-(5-methylthiophen-2-yl)-N-(2-phenylethyl)acetamide;hydrochloride (PubChem CID 120884701) has the molecular formula C17H23ClN2OS and a molecular weight of 338.90 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(5-methylthiophen-2-yl)-N-(2-phenylethyl)acetamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-(5-methylthiophen-2-yl)-N-(2-phenylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120884701 |
| Molecular Formula | C17H23ClN2OS |
| Molecular Weight | 338.90 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-(2-aminoethyl)-2-(5-methylthiophen-2-yl)-N-(2-phenylethyl)acetamide;hydrochloride |
| SMILES | Cc1ccc(CC(=O)N(CCN)CCc2ccccc2)s1.Cl |
| InChI | InChI=1S/C17H22N2OS.ClH/c1-14-7-8-16(21-14)13-17(20)19(12-10-18)11-9-15-5-3-2-4-6-15;/h2-8H,9-13,18H2,1H3;1H |
| InChIKey | OEGRQHOBDUIERH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.90 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |