C19H27ClN2OS — CID 120559324
4-amino-N-[(5-methylthiophen-2-yl)methyl]-N-(2-phenylethyl)pentanamide;hydrochloride (PubChem CID 120559324) has the molecular formula C19H27ClN2OS and a molecular weight of 366.96 g/mol. Its IUPAC name is 4-amino-N-[(5-methylthiophen-2-yl)methyl]-N-(2-phenylethyl)pentanamide;hydrochloride.
| Compound Name | 4-amino-N-[(5-methylthiophen-2-yl)methyl]-N-(2-phenylethyl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120559324 |
| Molecular Formula | C19H27ClN2OS |
| Molecular Weight | 366.96 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-amino-N-[(5-methylthiophen-2-yl)methyl]-N-(2-phenylethyl)pentanamide;hydrochloride |
| SMILES | Cc1ccc(CN(CCc2ccccc2)C(=O)CCC(C)N)s1.Cl |
| InChI | InChI=1S/C19H26N2OS.ClH/c1-15(20)8-11-19(22)21(14-18-10-9-16(2)23-18)13-12-17-6-4-3-5-7-17;/h3-7,9-10,15H,8,11-14,20H2,1-2H3;1H |
| InChIKey | BJXAHMQERAKWAW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.96 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |