C24H26N2O3S — CID 9289566
[2-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl] 3-amino-4-methylbenzoate (PubChem CID 9289566) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is [2-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl] 3-amino-4-methylbenzoate.
| Compound Name | [2-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl] 3-amino-4-methylbenzoate |
|---|---|
| PubChem CID | 9289566 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [2-[(5-methylthiophen-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl] 3-amino-4-methylbenzoate |
| SMILES | Cc1ccc(CN(CCc2ccccc2)C(=O)COC(=O)c2ccc(C)c(N)c2)s1 |
| InChI | InChI=1S/C24H26N2O3S/c1-17-8-10-20(14-22(17)25)24(28)29-16-23(27)26(15-21-11-9-18(2)30-21)13-12-19-6-4-3-5-7-19/h3-11,14H,12-13,15-16,25H2,1-2H3 |
| InChIKey | KFNYNNLRASTBIM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|