C21H26N2O3 — CID 9289469
[2-[(4-methylphenyl)methyl-propylamino]-2-oxoethyl] 3-amino-4-methylbenzoate (PubChem CID 9289469) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is [2-[(4-methylphenyl)methyl-propylamino]-2-oxoethyl] 3-amino-4-methylbenzoate.
| Compound Name | [2-[(4-methylphenyl)methyl-propylamino]-2-oxoethyl] 3-amino-4-methylbenzoate |
|---|---|
| PubChem CID | 9289469 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [2-[(4-methylphenyl)methyl-propylamino]-2-oxoethyl] 3-amino-4-methylbenzoate |
| SMILES | CCCN(Cc1ccc(C)cc1)C(=O)COC(=O)c1ccc(C)c(N)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-4-11-23(13-17-8-5-15(2)6-9-17)20(24)14-26-21(25)18-10-7-16(3)19(22)12-18/h5-10,12H,4,11,13-14,22H2,1-3H3 |
| InChIKey | VEAIKZHGABXXCY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|