C23H28N2O5 — CID 9345553
[2-[(4-methylphenyl)methyl-propylamino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate (PubChem CID 9345553) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is [2-[(4-methylphenyl)methyl-propylamino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate.
| Compound Name | [2-[(4-methylphenyl)methyl-propylamino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9345553 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [2-[(4-methylphenyl)methyl-propylamino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate |
| SMILES | CCCN(Cc1ccc(C)cc1)C(=O)COC(=O)CNC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H28N2O5/c1-4-13-25(15-18-7-5-17(2)6-8-18)21(26)16-30-22(27)14-24-23(28)19-9-11-20(29-3)12-10-19/h5-12H,4,13-16H2,1-3H3,(H,24,28) |
| InChIKey | UEKHKSIWZBGERI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |