C17H20ClN3O4S — CID 38171543
N-(2-chlorophenyl)-2-[methyl-[2-(4-sulfamoylphenoxy)ethyl]amino]acetamide (PubChem CID 38171543) has the molecular formula C17H20ClN3O4S and a molecular weight of 397.88 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[methyl-[2-(4-sulfamoylphenoxy)ethyl]amino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[methyl-[2-(4-sulfamoylphenoxy)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 38171543 |
| Molecular Formula | C17H20ClN3O4S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-(2-chlorophenyl)-2-[methyl-[2-(4-sulfamoylphenoxy)ethyl]amino]acetamide |
| SMILES | CN(CCOc1ccc(S(N)(=O)=O)cc1)CC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H20ClN3O4S/c1-21(12-17(22)20-16-5-3-2-4-15(16)18)10-11-25-13-6-8-14(9-7-13)26(19,23)24/h2-9H,10-12H2,1H3,(H,20,22)(H2,19,23,24) |
| InChIKey | MHXPSZKFOKPTEU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |