C18H21Cl2N3O4S — CID 34926420
N-(2,6-dichlorophenyl)-2-[ethyl-[2-(4-sulfamoylphenoxy)ethyl]amino]acetamide (PubChem CID 34926420) has the molecular formula C18H21Cl2N3O4S and a molecular weight of 446.36 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[ethyl-[2-(4-sulfamoylphenoxy)ethyl]amino]acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[ethyl-[2-(4-sulfamoylphenoxy)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 34926420 |
| Molecular Formula | C18H21Cl2N3O4S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[ethyl-[2-(4-sulfamoylphenoxy)ethyl]amino]acetamide |
| SMILES | CCN(CCOc1ccc(S(N)(=O)=O)cc1)CC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H21Cl2N3O4S/c1-2-23(12-17(24)22-18-15(19)4-3-5-16(18)20)10-11-27-13-6-8-14(9-7-13)28(21,25)26/h3-9H,2,10-12H2,1H3,(H,22,24)(H2,21,25,26) |
| InChIKey | AOKKWTPUDFSCOX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |