C16H24N2O4 — CID 8792057
ethyl N-[2-[ethyl-[2-(4-methylphenoxy)ethyl]amino]acetyl]carbamate (PubChem CID 8792057) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl N-[2-[ethyl-[2-(4-methylphenoxy)ethyl]amino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[ethyl-[2-(4-methylphenoxy)ethyl]amino]acetyl]carbamate |
|---|---|
| PubChem CID | 8792057 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | ethyl N-[2-[ethyl-[2-(4-methylphenoxy)ethyl]amino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(CC)CCOc1ccc(C)cc1 |
| InChI | InChI=1S/C16H24N2O4/c1-4-18(12-15(19)17-16(20)21-5-2)10-11-22-14-8-6-13(3)7-9-14/h6-9H,4-5,10-12H2,1-3H3,(H,17,19,20) |
| InChIKey | NSBFGVRPTCTEPH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |