C20H22Cl2N2O3 — CID 24553205
N-[2-(2,6-dichloroanilino)-2-oxoethyl]-2-(4-ethoxyphenyl)-N-ethylacetamide (PubChem CID 24553205) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is N-[2-(2,6-dichloroanilino)-2-oxoethyl]-2-(4-ethoxyphenyl)-N-ethylacetamide.
| Compound Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-2-(4-ethoxyphenyl)-N-ethylacetamide |
|---|---|
| PubChem CID | 24553205 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-2-(4-ethoxyphenyl)-N-ethylacetamide |
| SMILES | CCOc1ccc(CC(=O)N(CC)CC(=O)Nc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O3/c1-3-24(13-18(25)23-20-16(21)6-5-7-17(20)22)19(26)12-14-8-10-15(11-9-14)27-4-2/h5-11H,3-4,12-13H2,1-2H3,(H,23,25) |
| InChIKey | CRXGLAOLESHJLQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |