C17H18ClFN2O2 — CID 8797671
N-(2-chloro-4-fluorophenyl)-2-[methyl(2-phenoxyethyl)amino]acetamide (PubChem CID 8797671) has the molecular formula C17H18ClFN2O2 and a molecular weight of 336.79 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-[methyl(2-phenoxyethyl)amino]acetamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-[methyl(2-phenoxyethyl)amino]acetamide |
|---|---|
| PubChem CID | 8797671 |
| Molecular Formula | C17H18ClFN2O2 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-[methyl(2-phenoxyethyl)amino]acetamide |
| SMILES | CN(CCOc1ccccc1)CC(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H18ClFN2O2/c1-21(9-10-23-14-5-3-2-4-6-14)12-17(22)20-16-8-7-13(19)11-15(16)18/h2-8,11H,9-10,12H2,1H3,(H,20,22) |
| InChIKey | OVIFUDRNYFQIPA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |