C33H50O6S2 — CID 167351543
tert-butyl 4-[4-[2-[2-[4-(4-tert-butylphenoxy)butoxy]ethyldisulfanyl]ethoxy]butoxy]benzoate (PubChem CID 167351543) has the molecular formula C33H50O6S2 and a molecular weight of 606.89 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-[2-[4-(4-tert-butylphenoxy)butoxy]ethyldisulfanyl]ethoxy]butoxy]benzoate.
| Compound Name | tert-butyl 4-[4-[2-[2-[4-(4-tert-butylphenoxy)butoxy]ethyldisulfanyl]ethoxy]butoxy]benzoate |
|---|---|
| PubChem CID | 167351543 |
| Molecular Formula | C33H50O6S2 |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | tert-butyl 4-[4-[2-[2-[4-(4-tert-butylphenoxy)butoxy]ethyldisulfanyl]ethoxy]butoxy]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(OCCCCOCCSSCCOCCCCOc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H50O6S2/c1-32(2,3)28-13-17-30(18-14-28)38-22-10-8-20-36-24-26-41-40-25-23-35-19-7-9-21-37-29-15-11-27(12-16-29)31(34)39-33(4,5)6/h11-18H,7-10,19-26H2,1-6H3 |
| InChIKey | WZCWHMLLWZODQU-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|