C22H25NO3 — CID 71767440
4-[(3aS,4R,9bR)-8-methoxy-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3-ethylbenzoic acid (PubChem CID 71767440) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[(3aS,4R,9bR)-8-methoxy-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3-ethylbenzoic acid.
| Compound Name | 4-[(3aS,4R,9bR)-8-methoxy-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3-ethylbenzoic acid |
|---|---|
| PubChem CID | 71767440 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-[(3aS,4R,9bR)-8-methoxy-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3-ethylbenzoic acid |
| SMILES | CCc1cc(C(=O)O)ccc1[C@@H]1Nc2ccc(OC)cc2[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C22H25NO3/c1-3-13-11-14(22(24)25)7-9-16(13)21-18-6-4-5-17(18)19-12-15(26-2)8-10-20(19)23-21/h7-12,17-18,21,23H,3-6H2,1-2H3,(H,24,25)/t17-,18+,21+/m1/s1 |
| InChIKey | HESXYSLZVISCIS-LQWHRVPQSA-N |
| XLogP | 5.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|