C22H25NO2 — CID 71767442
4-[(3aS,4S,9bR)-8-methyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3,5-dimethylbenzoic acid (PubChem CID 71767442) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-[(3aS,4S,9bR)-8-methyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3,5-dimethylbenzoic acid.
| Compound Name | 4-[(3aS,4S,9bR)-8-methyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 71767442 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 4-[(3aS,4S,9bR)-8-methyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3,5-dimethylbenzoic acid |
| SMILES | Cc1ccc2c(c1)[C@@H]1CCC[C@@H]1[C@@H](c1c(C)cc(C(=O)O)cc1C)N2 |
| InChI | InChI=1S/C22H25NO2/c1-12-7-8-19-18(9-12)16-5-4-6-17(16)21(23-19)20-13(2)10-15(22(24)25)11-14(20)3/h7-11,16-17,21,23H,4-6H2,1-3H3,(H,24,25)/t16-,17+,21+/m1/s1 |
| InChIKey | FPNKNXXWEKEBAB-WWMYMODYSA-N |
| XLogP | 5.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |