C25H29NO3 — CID 154233016
methyl 4-[(3aS,4R,9bR)-8-(cyclopropylmethoxy)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3-methylbenzoate (PubChem CID 154233016) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is methyl 4-[(3aS,4R,9bR)-8-(cyclopropylmethoxy)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[(3aS,4R,9bR)-8-(cyclopropylmethoxy)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 154233016 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | methyl 4-[(3aS,4R,9bR)-8-(cyclopropylmethoxy)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc([C@@H]2Nc3ccc(OCC4CC4)cc3[C@@H]3CCC[C@@H]32)c(C)c1 |
| InChI | InChI=1S/C25H29NO3/c1-15-12-17(25(27)28-2)8-10-19(15)24-21-5-3-4-20(21)22-13-18(9-11-23(22)26-24)29-14-16-6-7-16/h8-13,16,20-21,24,26H,3-7,14H2,1-2H3/t20-,21+,24+/m1/s1 |
| InChIKey | JMGUOOJGHBKRSG-DPLHUUCSSA-N |
| XLogP | 5.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|