C20H22N2O — CID 76689500
(9-methyl-3,4,5,5a,6,10b-hexahydro-1H-azepino[4,3-b]indol-2-yl)-phenylmethanone (PubChem CID 76689500) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (9-methyl-3,4,5,5a,6,10b-hexahydro-1H-azepino[4,3-b]indol-2-yl)-phenylmethanone.
| Compound Name | (9-methyl-3,4,5,5a,6,10b-hexahydro-1H-azepino[4,3-b]indol-2-yl)-phenylmethanone |
|---|---|
| PubChem CID | 76689500 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (9-methyl-3,4,5,5a,6,10b-hexahydro-1H-azepino[4,3-b]indol-2-yl)-phenylmethanone |
| SMILES | Cc1ccc2c(c1)C1CN(C(=O)c3ccccc3)CCCC1N2 |
| InChI | InChI=1S/C20H22N2O/c1-14-9-10-19-16(12-14)17-13-22(11-5-8-18(17)21-19)20(23)15-6-3-2-4-7-15/h2-4,6-7,9-10,12,17-18,21H,5,8,11,13H2,1H3 |
| InChIKey | DLLUWSLMBAKVIK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |