C12H15N — CID 84654717
7-methyl-1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole (PubChem CID 84654717) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 7-methyl-1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole.
| Compound Name | 7-methyl-1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 84654717 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 7-methyl-1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole |
| SMILES | Cc1ccc2c(c1)C1CCCC1N2 |
| InChI | InChI=1S/C12H15N/c1-8-5-6-12-10(7-8)9-3-2-4-11(9)13-12/h5-7,9,11,13H,2-4H2,1H3 |
| InChIKey | GISQTDCMVMCOLJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |