C13H18N2 — CID 71128959
(10bR)-9-methyl-1,2,3,4,5,5a,6,10b-octahydroazepino[4,3-b]indole (PubChem CID 71128959) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (10bR)-9-methyl-1,2,3,4,5,5a,6,10b-octahydroazepino[4,3-b]indole.
| Compound Name | (10bR)-9-methyl-1,2,3,4,5,5a,6,10b-octahydroazepino[4,3-b]indole |
|---|---|
| PubChem CID | 71128959 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (10bR)-9-methyl-1,2,3,4,5,5a,6,10b-octahydroazepino[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)[C@@H]1CNCCCC1N2 |
| InChI | InChI=1S/C13H18N2/c1-9-4-5-13-10(7-9)11-8-14-6-2-3-12(11)15-13/h4-5,7,11-12,14-15H,2-3,6,8H2,1H3/t11-,12?/m0/s1 |
| InChIKey | KSWQOIMPWVMAOV-PXYINDEMSA-N |
| XLogP | 2.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |