C14H18N2O2 — CID 82372244
methyl 8-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate (PubChem CID 82372244) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is methyl 8-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate.
| Compound Name | methyl 8-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 82372244 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | methyl 8-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole-2-carboxylate |
| SMILES | COC(=O)N1CCC2Nc3ccc(C)cc3C2C1 |
| InChI | InChI=1S/C14H18N2O2/c1-9-3-4-12-10(7-9)11-8-16(14(17)18-2)6-5-13(11)15-12/h3-4,7,11,13,15H,5-6,8H2,1-2H3 |
| InChIKey | NIUSONBTQREXMM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |