C18H22N2O4 — CID 101237710
5-O-ethyl 1-O-methyl (4aS,5S,10bS)-9-methyl-4a,5,6,10b-tetrahydro-2H-benzo[h][1,6]naphthyridine-1,5-dicarboxylate (PubChem CID 101237710) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl (4aS,5S,10bS)-9-methyl-4a,5,6,10b-tetrahydro-2H-benzo[h][1,6]naphthyridine-1,5-dicarboxylate.
| Compound Name | 5-O-ethyl 1-O-methyl (4aS,5S,10bS)-9-methyl-4a,5,6,10b-tetrahydro-2H-benzo[h][1,6]naphthyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 101237710 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 5-O-ethyl 1-O-methyl (4aS,5S,10bS)-9-methyl-4a,5,6,10b-tetrahydro-2H-benzo[h][1,6]naphthyridine-1,5-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1Nc2ccc(C)cc2[C@@H]2[C@H]1C=CCN2C(=O)OC |
| InChI | InChI=1S/C18H22N2O4/c1-4-24-17(21)15-12-6-5-9-20(18(22)23-3)16(12)13-10-11(2)7-8-14(13)19-15/h5-8,10,12,15-16,19H,4,9H2,1-3H3/t12-,15-,16-/m0/s1 |
| InChIKey | VWKXDJXIASLRET-RCBQFDQVSA-N |
| XLogP | 2.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|