C18H26N2O2 — CID 140575490
tert-butyl (5aR,10bS)-9-methyl-3,4,5,5a,6,10b-hexahydro-1H-azepino[4,3-b]indole-2-carboxylate (PubChem CID 140575490) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is tert-butyl (5aR,10bS)-9-methyl-3,4,5,5a,6,10b-hexahydro-1H-azepino[4,3-b]indole-2-carboxylate.
| Compound Name | tert-butyl (5aR,10bS)-9-methyl-3,4,5,5a,6,10b-hexahydro-1H-azepino[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 140575490 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl (5aR,10bS)-9-methyl-3,4,5,5a,6,10b-hexahydro-1H-azepino[4,3-b]indole-2-carboxylate |
| SMILES | Cc1ccc2c(c1)[C@H]1CN(C(=O)OC(C)(C)C)CCC[C@H]1N2 |
| InChI | InChI=1S/C18H26N2O2/c1-12-7-8-16-13(10-12)14-11-20(9-5-6-15(14)19-16)17(21)22-18(2,3)4/h7-8,10,14-15,19H,5-6,9,11H2,1-4H3/t14-,15-/m1/s1 |
| InChIKey | URFYRXGAHYSRDH-HUUCEWRRSA-N |
| XLogP | 3.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |