C21H31BrN2O4 — CID 171497869
ditert-butyl 2-(2-bromo-5-methylphenyl)piperazine-1,4-dicarboxylate (PubChem CID 171497869) has the molecular formula C21H31BrN2O4 and a molecular weight of 455.39 g/mol. Its IUPAC name is ditert-butyl 2-(2-bromo-5-methylphenyl)piperazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl 2-(2-bromo-5-methylphenyl)piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 171497869 |
| Molecular Formula | C21H31BrN2O4 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | ditert-butyl 2-(2-bromo-5-methylphenyl)piperazine-1,4-dicarboxylate |
| SMILES | Cc1ccc(Br)c(C2CN(C(=O)OC(C)(C)C)CCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H31BrN2O4/c1-14-8-9-16(22)15(12-14)17-13-23(18(25)27-20(2,3)4)10-11-24(17)19(26)28-21(5,6)7/h8-9,12,17H,10-11,13H2,1-7H3 |
| InChIKey | FKRKEAVVJSAWAX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |