C26H38N2O3 — CID 129211811
tert-butyl 2-(2,4-dimethylphenyl)-4-(2-methyl-2-prop-2-enylpent-4-enoyl)piperazine-1-carboxylate (PubChem CID 129211811) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is tert-butyl 2-(2,4-dimethylphenyl)-4-(2-methyl-2-prop-2-enylpent-4-enoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-(2,4-dimethylphenyl)-4-(2-methyl-2-prop-2-enylpent-4-enoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 129211811 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | tert-butyl 2-(2,4-dimethylphenyl)-4-(2-methyl-2-prop-2-enylpent-4-enoyl)piperazine-1-carboxylate |
| SMILES | C=CCC(C)(CC=C)C(=O)N1CCN(C(=O)OC(C)(C)C)C(c2ccc(C)cc2C)C1 |
| InChI | InChI=1S/C26H38N2O3/c1-9-13-26(8,14-10-2)23(29)27-15-16-28(24(30)31-25(5,6)7)22(18-27)21-12-11-19(3)17-20(21)4/h9-12,17,22H,1-2,13-16,18H2,3-8H3 |
| InChIKey | OIDAFOXYCDOGLZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|