C26H36N2O3 — CID 121482917
tert-butyl (1S,8aS)-1-(2,4-dimethylphenyl)-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate (PubChem CID 121482917) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is tert-butyl (1S,8aS)-1-(2,4-dimethylphenyl)-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate.
| Compound Name | tert-butyl (1S,8aS)-1-(2,4-dimethylphenyl)-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 121482917 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | tert-butyl (1S,8aS)-1-(2,4-dimethylphenyl)-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
| SMILES | C=CCC1(CC=C)C[C@H]2[C@H](c3ccc(C)cc3C)N(C(=O)OC(C)(C)C)CCN2C1=O |
| InChI | InChI=1S/C26H36N2O3/c1-8-12-26(13-9-2)17-21-22(20-11-10-18(3)16-19(20)4)28(15-14-27(21)23(26)29)24(30)31-25(5,6)7/h8-11,16,21-22H,1-2,12-15,17H2,3-7H3/t21-,22-/m0/s1 |
| InChIKey | CPQDPCAZOGVBLH-VXKWHMMOSA-N |
| XLogP | 5.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|